About methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate
methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate (PubChem CID 167333617) has the molecular formula C10H7BrF2O4S
and a molecular weight of 341.13 g/mol. Its IUPAC name is methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate.
Molecular Properties
| Compound Name | methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate |
| PubChem CID | 167333617 |
| Molecular Formula | C10H7BrF2O4S |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate |
| SMILES | COS(=O)(=O)c1c(F)cc(Br)c2c1C(=O)C(F)C2 |
| InChI | InChI=1S/C10H7BrF2O4S/c1-17-18(15,16)10-7(13)3-5(11)4-2-6(12)9(14)8(4)10/h3,6H,2H2,1H3 |
| InChIKey | ZQYYPNWNTIDUCB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate?
The IUPAC name of methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate (CID 167333617) is methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate.
What is the SMILES notation for methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate?
The canonical SMILES for methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate is COS(=O)(=O)c1c(F)cc(Br)c2c1C(=O)C(F)C2.
What is the InChIKey of methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate?
The InChIKey is ZQYYPNWNTIDUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF2O4S/c1-17-18(15,16)10-7(13)3-5(11)4-2-6(12)9(14)8(4)10/h3,6H,2H2,1H3.
What are the key properties of methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate?
methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate has a molecular weight of 341.13 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-bromo-2,5-difluoro-3-oxo-1,2-dihydroindene-4-sulfonate is sourced from PubChem (CID 167333617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).