C10H2Br4F6O3 — CID 167333620
(2,3,4,6-tetrabromophenyl) 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 167333620) has the molecular formula C10H2Br4F6O3 and a molecular weight of 603.73 g/mol. Its IUPAC name is (2,3,4,6-tetrabromophenyl) 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
| Compound Name | (2,3,4,6-tetrabromophenyl) 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 167333620 |
| Molecular Formula | C10H2Br4F6O3 |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 599.66 |
| IUPAC Name | (2,3,4,6-tetrabromophenyl) 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | O=C(Oc1c(Br)cc(Br)c(Br)c1Br)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H2Br4F6O3/c11-2-1-3(12)6(5(14)4(2)13)23-7(21)8(22,9(15,16)17)10(18,19)20/h1,22H |
| InChIKey | HLKIYKISHXKJIQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|