C10H3F8O3- — CID 167333701
2-(3,4-difluorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate (PubChem CID 167333701) has the molecular formula C10H3F8O3- and a molecular weight of 323.12 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate.
| Compound Name | 2-(3,4-difluorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 167333701 |
| Molecular Formula | C10H3F8O3- |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2-(3,4-difluorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate |
| SMILES | O=C(Oc1ccc(F)c(F)c1)C([O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H3F8O3/c11-5-2-1-4(3-6(5)12)21-7(19)8(20,9(13,14)15)10(16,17)18/h1-3H/q-1 |
| InChIKey | AASAFXMXLXMUSC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|