C67H46N2 — CID 167334215
2,3,5,6-tetradeuterio-N,N-bis(4-phenylphenyl)-4-[9-phenyl-6-(9-phenylfluoren-9-yl)carbazol-3-yl]aniline (PubChem CID 167334215) has the molecular formula C67H46N2 and a molecular weight of 883.14 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N,N-bis(4-phenylphenyl)-4-[9-phenyl-6-(9-phenylfluoren-9-yl)carbazol-3-yl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N,N-bis(4-phenylphenyl)-4-[9-phenyl-6-(9-phenylfluoren-9-yl)carbazol-3-yl]aniline |
|---|---|
| PubChem CID | 167334215 |
| Molecular Formula | C67H46N2 |
| Molecular Weight | 883.14 g/mol |
| Exact Mass | 882.39 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N,N-bis(4-phenylphenyl)-4-[9-phenyl-6-(9-phenylfluoren-9-yl)carbazol-3-yl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)c([2H])c([2H])c1-c1ccc2c(c1)c1cc(C3(c4ccccc4)c4ccccc4-c4ccccc43)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C67H46N2/c1-5-17-47(18-6-1)49-29-37-56(38-30-49)68(57-39-31-50(32-40-57)48-19-7-2-8-20-48)58-41-33-51(34-42-58)52-35-43-65-61(45-52)62-46-54(36-44-66(62)69(65)55-23-11-4-12-24-55)67(53-21-9-3-10-22-53)63-27-15-13-25-59(63)60-26-14-16-28-64(60)67/h1-46H/i33D,34D,41D,42D |
| InChIKey | DSAWRFCNGKOKDA-CYKDLDSFSA-N |
| XLogP | 17.62 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.14 |
| LogP ≤ 5 | 17.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |