C23H22ClN5O4 — CID 16733482
1-tert-butyl-3-[3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]urea (PubChem CID 16733482) has the molecular formula C23H22ClN5O4 and a molecular weight of 467.91 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]urea.
| Compound Name | 1-tert-butyl-3-[3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 16733482 |
| Molecular Formula | C23H22ClN5O4 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-tert-butyl-3-[3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]urea |
| SMILES | CC(C)(C)NC(=O)Nc1cccc(Cn2[nH]c(=O)c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)c1 |
| InChI | InChI=1S/C23H22ClN5O4/c1-23(2,3)27-22(33)25-14-6-4-5-12(9-14)11-29-21(32)17-18(20(31)28-29)26-16-10-13(24)7-8-15(16)19(17)30/h4-10H,11H2,1-3H3,(H,26,30)(H,28,31)(H2,25,27,33) |
| InChIKey | LZYYPODTGABYDK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|