C32H41F3O4 — CID 167334874
1-O-methyl 5-O-(2,2,2-trifluoroethyl) 2,4-dimethyl-2-(4-methyl-3,3-diphenylhexyl)-4-prop-2-enylpentanedioate (PubChem CID 167334874) has the molecular formula C32H41F3O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is 1-O-methyl 5-O-(2,2,2-trifluoroethyl) 2,4-dimethyl-2-(4-methyl-3,3-diphenylhexyl)-4-prop-2-enylpentanedioate.
| Compound Name | 1-O-methyl 5-O-(2,2,2-trifluoroethyl) 2,4-dimethyl-2-(4-methyl-3,3-diphenylhexyl)-4-prop-2-enylpentanedioate |
|---|---|
| PubChem CID | 167334874 |
| Molecular Formula | C32H41F3O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 1-O-methyl 5-O-(2,2,2-trifluoroethyl) 2,4-dimethyl-2-(4-methyl-3,3-diphenylhexyl)-4-prop-2-enylpentanedioate |
| SMILES | C=CCC(C)(CC(C)(CCC(c1ccccc1)(c1ccccc1)C(C)CC)C(=O)OC)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C32H41F3O4/c1-7-19-29(4,28(37)39-23-32(33,34)35)22-30(5,27(36)38-6)20-21-31(24(3)8-2,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h7,9-18,24H,1,8,19-23H2,2-6H3 |
| InChIKey | UIFVQBLSDBDRIZ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|