C15H20FNO4 — CID 167335023
benzyl (3S,4R,5R)-3-fluoro-4,5-dimethoxypiperidine-1-carboxylate (PubChem CID 167335023) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is benzyl (3S,4R,5R)-3-fluoro-4,5-dimethoxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S,4R,5R)-3-fluoro-4,5-dimethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167335023 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | benzyl (3S,4R,5R)-3-fluoro-4,5-dimethoxypiperidine-1-carboxylate |
| SMILES | CO[C@H]1[C@@H](F)CN(C(=O)OCc2ccccc2)C[C@H]1OC |
| InChI | InChI=1S/C15H20FNO4/c1-19-13-9-17(8-12(16)14(13)20-2)15(18)21-10-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13+,14-/m0/s1 |
| InChIKey | IJFSNDVRZVOHLI-MJBXVCDLSA-N |
| XLogP | 2.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |