C14H18BNO4 — CID 167335355
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-ethyl-1,3-benzoxazol-2-one (PubChem CID 167335355) has the molecular formula C14H18BNO4 and a molecular weight of 275.11 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-ethyl-1,3-benzoxazol-2-one.
| Compound Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-ethyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 167335355 |
| Molecular Formula | C14H18BNO4 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-ethyl-1,3-benzoxazol-2-one |
| SMILES | CCn1c(=O)oc2cccc(B3OCC(C)(C)CO3)c21 |
| InChI | InChI=1S/C14H18BNO4/c1-4-16-12-10(6-5-7-11(12)20-13(16)17)15-18-8-14(2,3)9-19-15/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | PKPYXMVROUTUFP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|