C15H10ClN3O3 — CID 16733655
2-but-3-yn-2-yl-7-chloro-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione (PubChem CID 16733655) has the molecular formula C15H10ClN3O3 and a molecular weight of 315.72 g/mol. Its IUPAC name is 2-but-3-yn-2-yl-7-chloro-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione.
| Compound Name | 2-but-3-yn-2-yl-7-chloro-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
|---|---|
| PubChem CID | 16733655 |
| Molecular Formula | C15H10ClN3O3 |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-but-3-yn-2-yl-7-chloro-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
| SMILES | C#CC(C)n1[nH]c(=O)c2[nH]c3cc(Cl)ccc3c(=O)c2c1=O |
| InChI | InChI=1S/C15H10ClN3O3/c1-3-7(2)19-15(22)11-12(14(21)18-19)17-10-6-8(16)4-5-9(10)13(11)20/h1,4-7H,2H3,(H,17,20)(H,18,21) |
| InChIKey | ZUQNHDHMGCBVJM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|