C26H27Cl2N4O4Y- — CID 167336754
2,6-dichloro-N-[2-[4-[2-methyl-5-(2-morpholin-4-ylethoxy)-3-oxopyridazin-4-yl]phenyl]ethyl]benzamide;yttrium (PubChem CID 167336754) has the molecular formula C26H27Cl2N4O4Y- and a molecular weight of 619.34 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-[4-[2-methyl-5-(2-morpholin-4-ylethoxy)-3-oxopyridazin-4-yl]phenyl]ethyl]benzamide;yttrium.
| Compound Name | 2,6-dichloro-N-[2-[4-[2-methyl-5-(2-morpholin-4-ylethoxy)-3-oxopyridazin-4-yl]phenyl]ethyl]benzamide;yttrium |
|---|---|
| PubChem CID | 167336754 |
| Molecular Formula | C26H27Cl2N4O4Y- |
| Molecular Weight | 619.34 g/mol |
| Exact Mass | 618.05 |
| IUPAC Name | 2,6-dichloro-N-[2-[4-[2-methyl-5-(2-morpholin-4-ylethoxy)-3-oxopyridazin-4-yl]phenyl]ethyl]benzamide;yttrium |
| SMILES | Cn1ncc(OCCN2CCOCC2)c(-c2ccc(C[CH-]NC(=O)c3c(Cl)cccc3Cl)cc2)c1=O.[Y] |
| InChI | InChI=1S/C26H27Cl2N4O4.Y/c1-31-26(34)23(22(17-30-31)36-16-13-32-11-14-35-15-12-32)19-7-5-18(6-8-19)9-10-29-25(33)24-20(27)3-2-4-21(24)28;/h2-8,10,17H,9,11-16H2,1H3,(H,29,33);/q-1; |
| InChIKey | WPQVVESTZZZSHS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|