About N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide
N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide (PubChem CID 167336881) has the molecular formula C6H9N3O3S2
and a molecular weight of 235.29 g/mol. Its IUPAC name is N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 167336881 |
| Molecular Formula | C6H9N3O3S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide |
| SMILES | CN(C)C(=O)c1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C6H9N3O3S2/c1-9(2)6(10)5-8-3-4(13-5)14(7,11)12/h3H,1-2H3,(H2,7,11,12) |
| InChIKey | FHKBUBDKTODIHX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide?
The IUPAC name of N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide (CID 167336881) is N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide is CN(C)C(=O)c1ncc(S(N)(=O)=O)s1.
What is the InChIKey of N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide?
The InChIKey is FHKBUBDKTODIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3S2/c1-9(2)6(10)5-8-3-4(13-5)14(7,11)12/h3H,1-2H3,(H2,7,11,12).
What are the key properties of N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide?
N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide has a molecular weight of 235.29 g/mol, XLogP of -0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-5-sulfamoyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 167336881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).