C24H35N5O5S2 — CID 167336953
1-[amino-[2-[1-(2-ethoxyethoxy)-2-hydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea (PubChem CID 167336953) has the molecular formula C24H35N5O5S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is 1-[amino-[2-[1-(2-ethoxyethoxy)-2-hydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea.
| Compound Name | 1-[amino-[2-[1-(2-ethoxyethoxy)-2-hydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
|---|---|
| PubChem CID | 167336953 |
| Molecular Formula | C24H35N5O5S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 1-[amino-[2-[1-(2-ethoxyethoxy)-2-hydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
| SMILES | CCOCCOCC(C)(O)c1ncc(S(N)(=O)=NC(=O)Nc2c3c(nc4c2CCC4(C)C)CCC3)s1 |
| InChI | InChI=1S/C24H35N5O5S2/c1-5-33-11-12-34-14-24(4,31)21-26-13-18(35-21)36(25,32)29-22(30)28-19-15-7-6-8-17(15)27-20-16(19)9-10-23(20,2)3/h13,31H,5-12,14H2,1-4H3,(H3,25,27,28,29,30,32) |
| InChIKey | NGQSEFMVNNCCBT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|