C26H32FN5O2S — CID 167337340
N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[3-methyl-1-(1-propylpyrazol-4-yl)sulfonylpiperidin-4-yl]aniline (PubChem CID 167337340) has the molecular formula C26H32FN5O2S and a molecular weight of 497.64 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[3-methyl-1-(1-propylpyrazol-4-yl)sulfonylpiperidin-4-yl]aniline.
| Compound Name | N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[3-methyl-1-(1-propylpyrazol-4-yl)sulfonylpiperidin-4-yl]aniline |
|---|---|
| PubChem CID | 167337340 |
| Molecular Formula | C26H32FN5O2S |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-(4-fluorophenyl)-2-methanimidoyl-5-methyl-4-[3-methyl-1-(1-propylpyrazol-4-yl)sulfonylpiperidin-4-yl]aniline |
| SMILES | [H]/N=C/c1cc(C2CCN(S(=O)(=O)c3cnn(CCC)c3)CC2C)c(C)cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H32FN5O2S/c1-4-10-31-17-23(15-29-31)35(33,34)32-11-9-24(19(3)16-32)25-13-20(14-28)26(12-18(25)2)30-22-7-5-21(27)6-8-22/h5-8,12-15,17,19,24,28,30H,4,9-11,16H2,1-3H3/b28-14+ |
| InChIKey | IZGBYCLHWBBXSK-CCVNUDIWSA-N |
| XLogP | 5.30 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|