C26H22F3N7 — CID 167337426
2-[1-(3,3-difluorocyclobutanecarboximidoyl)-2,3-dihydroindol-5-yl]-5-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]pyrimidin-4-amine (PubChem CID 167337426) has the molecular formula C26H22F3N7 and a molecular weight of 489.51 g/mol. Its IUPAC name is 2-[1-(3,3-difluorocyclobutanecarboximidoyl)-2,3-dihydroindol-5-yl]-5-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]pyrimidin-4-amine.
| Compound Name | 2-[1-(3,3-difluorocyclobutanecarboximidoyl)-2,3-dihydroindol-5-yl]-5-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167337426 |
| Molecular Formula | C26H22F3N7 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 2-[1-(3,3-difluorocyclobutanecarboximidoyl)-2,3-dihydroindol-5-yl]-5-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]pyrimidin-4-amine |
| SMILES | [H]/N=C(\C1CC(F)(F)C1)N1CCc2cc(-c3ncc(F)c(Nc4ccc(-c5cn[nH]c5)cc4)n3)ccc21 |
| InChI | InChI=1S/C26H22F3N7/c27-21-14-31-24(35-25(21)34-20-4-1-15(2-5-20)19-12-32-33-13-19)17-3-6-22-16(9-17)7-8-36(22)23(30)18-10-26(28,29)11-18/h1-6,9,12-14,18,30H,7-8,10-11H2,(H,32,33)(H,31,34,35)/b30-23+ |
| InChIKey | KTRSESUUEGANTB-JJKYIXSRSA-N |
| XLogP | 5.80 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|