C38H28F2IrN2O-2 — CID 167337735
6-(3,3-difluorocyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium;2-phenylpyridine (PubChem CID 167337735) has the molecular formula C38H28F2IrN2O-2 and a molecular weight of 758.87 g/mol. Its IUPAC name is 6-(3,3-difluorocyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium;2-phenylpyridine.
| Compound Name | 6-(3,3-difluorocyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 167337735 |
| Molecular Formula | C38H28F2IrN2O-2 |
| Molecular Weight | 758.87 g/mol |
| Exact Mass | 759.18 |
| IUPAC Name | 6-(3,3-difluorocyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium;2-phenylpyridine |
| SMILES | Cc1[c-]c(-c2nccc3cc(C4CCC(F)(F)C4)ccc23)c2oc3ccccc3c2c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C27H20F2NO.C11H8N.Ir/c1-16-12-22-21-4-2-3-5-24(21)31-26(22)23(13-16)25-20-7-6-17(14-18(20)9-11-30-25)19-8-10-27(28,29)15-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-7,9,11-12,14,19H,8,10,15H2,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | BIJATQQJCXLYQA-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.87 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|