C26H29BClN3O5 — CID 167338560
N-[2-chloro-3-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 167338560) has the molecular formula C26H29BClN3O5 and a molecular weight of 509.80 g/mol. Its IUPAC name is N-[2-chloro-3-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | N-[2-chloro-3-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 167338560 |
| Molecular Formula | C26H29BClN3O5 |
| Molecular Weight | 509.80 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-[2-chloro-3-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cccc1-c1cccc(NC(=O)c2cn(C)c(=O)n(C)c2=O)c1Cl |
| InChI | InChI=1S/C26H29BClN3O5/c1-15-16(10-8-12-19(15)27-35-25(2,3)26(4,5)36-27)17-11-9-13-20(21(17)28)29-22(32)18-14-30(6)24(34)31(7)23(18)33/h8-14H,1-7H3,(H,29,32) |
| InChIKey | QRDWIMJBMCDBNO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|