About 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine
1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine (PubChem CID 167338786) has the molecular formula C10H22N4O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine |
| PubChem CID | 167338786 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine |
| SMILES | CNC(C)(C)COCOCC(C)(C)N=[N+]=[N-] |
| InChI | InChI=1S/C10H22N4O2/c1-9(2,12-5)6-15-8-16-7-10(3,4)13-14-11/h12H,6-8H2,1-5H3 |
| InChIKey | NBWRWTMNHOAKDU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine?
The IUPAC name of 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine (CID 167338786) is 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine.
What is the SMILES notation for 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine?
The canonical SMILES for 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine is CNC(C)(C)COCOCC(C)(C)N=[N+]=[N-].
What is the InChIKey of 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine?
The InChIKey is NBWRWTMNHOAKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O2/c1-9(2,12-5)6-15-8-16-7-10(3,4)13-14-11/h12H,6-8H2,1-5H3.
What are the key properties of 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine?
1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine has a molecular weight of 230.31 g/mol, XLogP of 2.06, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-azido-2-methylpropoxy)methoxy]-N,2-dimethylpropan-2-amine is sourced from PubChem (CID 167338786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).