About 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline
1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline (PubChem CID 16733960) has the molecular formula C20H18FN5
and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline |
| PubChem CID | 16733960 |
| Molecular Formula | C20H18FN5 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline |
| SMILES | Fc1ccc(-n2ncc3cc(N4CCNCC4)c4cnccc4c32)cc1 |
| InChI | InChI=1S/C20H18FN5/c21-15-1-3-16(4-2-15)26-20-14(12-24-26)11-19(25-9-7-22-8-10-25)18-13-23-6-5-17(18)20/h1-6,11-13,22H,7-10H2 |
| InChIKey | PUAIFJNHFQLMNO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline?
The IUPAC name of 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline (CID 16733960) is 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline.
What is the SMILES notation for 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline?
The canonical SMILES for 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline is Fc1ccc(-n2ncc3cc(N4CCNCC4)c4cnccc4c32)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline?
The InChIKey is PUAIFJNHFQLMNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN5/c21-15-1-3-16(4-2-15)26-20-14(12-24-26)11-19(25-9-7-22-8-10-25)18-13-23-6-5-17(18)20/h1-6,11-13,22H,7-10H2.
What are the key properties of 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline?
1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline has a molecular weight of 347.40 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-5-piperazin-1-ylpyrazolo[3,4-f]isoquinoline is sourced from PubChem (CID 16733960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).