About 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline
6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline (PubChem CID 167340308) has the molecular formula C16H16F3N
and a molecular weight of 279.31 g/mol. Its IUPAC name is 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline.
Molecular Properties
| Compound Name | 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline |
| PubChem CID | 167340308 |
| Molecular Formula | C16H16F3N |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline |
| SMILES | CC(C)[C@H]1C[C@@H]1c1ccc2cnc(C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C16H16F3N/c1-9(2)13-7-14(13)10-3-4-11-8-20-15(16(17,18)19)6-12(11)5-10/h3-6,8-9,13-14H,7H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | KFOQTJUWRJUFCH-ZIAGYGMSSA-N |
| XLogP | 5.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline?
The IUPAC name of 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline (CID 167340308) is 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline.
What is the SMILES notation for 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline?
The canonical SMILES for 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline is CC(C)[C@H]1C[C@@H]1c1ccc2cnc(C(F)(F)F)cc2c1.
What is the InChIKey of 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline?
The InChIKey is KFOQTJUWRJUFCH-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H16F3N/c1-9(2)13-7-14(13)10-3-4-11-8-20-15(16(17,18)19)6-12(11)5-10/h3-6,8-9,13-14H,7H2,1-2H3/t13-,14-/m1/s1.
What are the key properties of 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline?
6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline has a molecular weight of 279.31 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S,2R)-2-propan-2-ylcyclopropyl]-3-(trifluoromethyl)isoquinoline is sourced from PubChem (CID 167340308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).