About 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline
5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline (PubChem CID 16734124) has the molecular formula C22H13F3N4
and a molecular weight of 390.37 g/mol. Its IUPAC name is 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline.
Molecular Properties
| Compound Name | 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline |
| PubChem CID | 16734124 |
| Molecular Formula | C22H13F3N4 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline |
| SMILES | FC(F)(F)c1cccc(-n2ncc3cc(-c4cccnc4)c4cnccc4c32)c1 |
| InChI | InChI=1S/C22H13F3N4/c23-22(24,25)16-4-1-5-17(10-16)29-21-15(12-28-29)9-19(14-3-2-7-26-11-14)20-13-27-8-6-18(20)21/h1-13H |
| InChIKey | GBPOLZVCPLNOKN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
The IUPAC name of 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline (CID 16734124) is 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline.
What is the SMILES notation for 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
The canonical SMILES for 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline is FC(F)(F)c1cccc(-n2ncc3cc(-c4cccnc4)c4cnccc4c32)c1.
What is the InChIKey of 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
The InChIKey is GBPOLZVCPLNOKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13F3N4/c23-22(24,25)16-4-1-5-17(10-16)29-21-15(12-28-29)9-19(14-3-2-7-26-11-14)20-13-27-8-6-18(20)21/h1-13H.
What are the key properties of 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline has a molecular weight of 390.37 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-3-yl-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline is sourced from PubChem (CID 16734124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).