C28H41N5O2 — CID 167341646
[5-[2-(4-morpholin-4-ylphenyl)ethylamino]-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-piperidin-1-ylmethanone (PubChem CID 167341646) has the molecular formula C28H41N5O2 and a molecular weight of 479.67 g/mol. Its IUPAC name is [5-[2-(4-morpholin-4-ylphenyl)ethylamino]-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [5-[2-(4-morpholin-4-ylphenyl)ethylamino]-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 167341646 |
| Molecular Formula | C28H41N5O2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | [5-[2-(4-morpholin-4-ylphenyl)ethylamino]-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-piperidin-1-ylmethanone |
| SMILES | CCCn1nc(C(=O)N2CCCCC2)c2c1CCC(NCCc1ccc(N3CCOCC3)cc1)C2 |
| InChI | InChI=1S/C28H41N5O2/c1-2-14-33-26-11-8-23(21-25(26)27(30-33)28(34)32-15-4-3-5-16-32)29-13-12-22-6-9-24(10-7-22)31-17-19-35-20-18-31/h6-7,9-10,23,29H,2-5,8,11-21H2,1H3 |
| InChIKey | KIMNXDABBSXOKI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|