C17H17ClF2N2O2 — CID 167343176
ethyl 5-amino-3-chloro-2-[6-(1,1-difluoropropyl)-3-pyridinyl]benzoate (PubChem CID 167343176) has the molecular formula C17H17ClF2N2O2 and a molecular weight of 354.78 g/mol. Its IUPAC name is ethyl 5-amino-3-chloro-2-[6-(1,1-difluoropropyl)-3-pyridinyl]benzoate.
| Compound Name | ethyl 5-amino-3-chloro-2-[6-(1,1-difluoropropyl)-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 167343176 |
| Molecular Formula | C17H17ClF2N2O2 |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | ethyl 5-amino-3-chloro-2-[6-(1,1-difluoropropyl)-3-pyridinyl]benzoate |
| SMILES | CCOC(=O)c1cc(N)cc(Cl)c1-c1ccc(C(F)(F)CC)nc1 |
| InChI | InChI=1S/C17H17ClF2N2O2/c1-3-17(19,20)14-6-5-10(9-22-14)15-12(16(23)24-4-2)7-11(21)8-13(15)18/h5-9H,3-4,21H2,1-2H3 |
| InChIKey | YWZUBUMYNLKYIL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|