About CID 167343614
CID 167343614 (PubChem CID 167343614) has the molecular formula C32H37F3N10O2Si
and a molecular weight of 678.80 g/mol.
Molecular Properties
| Compound Name | CID 167343614 |
| PubChem CID | 167343614 |
| Molecular Formula | C32H37F3N10O2Si |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]COCn1ccc2c(-c3cnn(C4(CC#N)CN(C5CCN(C(=O)Nc6ccncc6C(F)(F)F)CC5)C4)c3)ncnc21 |
| InChI | InChI=1S/C32H37F3N10O2Si/c1-30(2,3)48-21-47-20-43-13-7-24-27(38-19-39-28(24)43)22-14-40-45(16-22)31(8-9-36)17-44(18-31)23-5-11-42(12-6-23)29(46)41-26-4-10-37-15-25(26)32(33,34)35/h4,7,10,13-16,19,23H,5-6,8,11-12,17-18,20-21H2,1-3H3,(H,37,41,46) |
| InChIKey | LRPCXICGAKOSQE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167343614 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167343614?
The IUPAC name of CID 167343614 (CID 167343614) is not available.
What is the SMILES notation for CID 167343614?
The canonical SMILES for CID 167343614 is CC(C)(C)[Si]COCn1ccc2c(-c3cnn(C4(CC#N)CN(C5CCN(C(=O)Nc6ccncc6C(F)(F)F)CC5)C4)c3)ncnc21.
What is the InChIKey of CID 167343614?
The InChIKey is LRPCXICGAKOSQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H37F3N10O2Si/c1-30(2,3)48-21-47-20-43-13-7-24-27(38-19-39-28(24)43)22-14-40-45(16-22)31(8-9-36)17-44(18-31)23-5-11-42(12-6-23)29(46)41-26-4-10-37-15-25(26)32(33,34)35/h4,7,10,13-16,19,23H,5-6,8,11-12,17-18,20-21H2,1-3H3,(H,37,41,46).
What are the key properties of CID 167343614?
CID 167343614 has a molecular weight of 678.80 g/mol, XLogP of 5.18, 9 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167343614 is sourced from PubChem (CID 167343614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).