C26H28F3NO3S — CID 16734476
3-[2,5-dimethyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propoxy]phenyl]-2,2-dimethylpropanoic acid (PubChem CID 16734476) has the molecular formula C26H28F3NO3S and a molecular weight of 491.58 g/mol. Its IUPAC name is 3-[2,5-dimethyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propoxy]phenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[2,5-dimethyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propoxy]phenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 16734476 |
| Molecular Formula | C26H28F3NO3S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 3-[2,5-dimethyl-4-[3-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propoxy]phenyl]-2,2-dimethylpropanoic acid |
| SMILES | Cc1cc(OCCCc2nc(-c3ccc(C(F)(F)F)cc3)cs2)c(C)cc1CC(C)(C)C(=O)O |
| InChI | InChI=1S/C26H28F3NO3S/c1-16-13-22(17(2)12-19(16)14-25(3,4)24(31)32)33-11-5-6-23-30-21(15-34-23)18-7-9-20(10-8-18)26(27,28)29/h7-10,12-13,15H,5-6,11,14H2,1-4H3,(H,31,32) |
| InChIKey | QPDODWBPQUTCCG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|