C15H17N3 — CID 167345618
10-methyl-10,16,17-triazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene (PubChem CID 167345618) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 10-methyl-10,16,17-triazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene.
| Compound Name | 10-methyl-10,16,17-triazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene |
|---|---|
| PubChem CID | 167345618 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 10-methyl-10,16,17-triazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene |
| SMILES | CN1Cc2cccc(n2)CCc2cccc(n2)C1 |
| InChI | InChI=1S/C15H17N3/c1-18-10-14-6-2-4-12(16-14)8-9-13-5-3-7-15(11-18)17-13/h2-7H,8-11H2,1H3 |
| InChIKey | OGHSPXAAZHVMCO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |