C27H54O7Si — CID 167346244
(2S,3S,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,8-trimethyl-5-propanoyloxytridecanoic acid (PubChem CID 167346244) has the molecular formula C27H54O7Si and a molecular weight of 518.81 g/mol. Its IUPAC name is (2S,3S,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,8-trimethyl-5-propanoyloxytridecanoic acid.
| Compound Name | (2S,3S,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,8-trimethyl-5-propanoyloxytridecanoic acid |
|---|---|
| PubChem CID | 167346244 |
| Molecular Formula | C27H54O7Si |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (2S,3S,4S,5R,8S,9S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethoxy-2,4,8-trimethyl-5-propanoyloxytridecanoic acid |
| SMILES | CCC(=O)O[C@H](CC[C@H](C)[C@H](C[C@@H](CC)O[Si](C)(C)C(C)(C)C)OC)[C@H](C)[C@H](OC)[C@H](C)C(=O)O |
| InChI | InChI=1S/C27H54O7Si/c1-13-21(34-35(11,12)27(6,7)8)17-23(31-9)18(3)15-16-22(33-24(28)14-2)19(4)25(32-10)20(5)26(29)30/h18-23,25H,13-17H2,1-12H3,(H,29,30)/t18-,19-,20-,21+,22+,23-,25-/m0/s1 |
| InChIKey | NENIEPZNBALXAS-NDIMTLHXSA-N |
| XLogP | 6.30 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|