C29H25NO4 — CID 167346292
(17-benzyl-19-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methyl acetate (PubChem CID 167346292) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is (17-benzyl-19-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methyl acetate.
| Compound Name | (17-benzyl-19-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methyl acetate |
|---|---|
| PubChem CID | 167346292 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (17-benzyl-19-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methyl acetate |
| SMILES | CC(=O)OCC12c3ccccc3C(c3ccccc31)C1(C)C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C29H25NO4/c1-18(31)34-17-29-22-14-8-6-12-20(22)24(21-13-7-9-15-23(21)29)28(2)25(29)26(32)30(27(28)33)16-19-10-4-3-5-11-19/h3-15,24-25H,16-17H2,1-2H3 |
| InChIKey | FVIYGTLHONYTRH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|