C12H13F2N3O3 — CID 167346830
4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1-(3-methoxypropyl)pyridin-2-one (PubChem CID 167346830) has the molecular formula C12H13F2N3O3 and a molecular weight of 285.25 g/mol. Its IUPAC name is 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1-(3-methoxypropyl)pyridin-2-one.
| Compound Name | 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1-(3-methoxypropyl)pyridin-2-one |
|---|---|
| PubChem CID | 167346830 |
| Molecular Formula | C12H13F2N3O3 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1-(3-methoxypropyl)pyridin-2-one |
| SMILES | COCCCn1ccc(-c2nnc(C(F)F)o2)cc1=O |
| InChI | InChI=1S/C12H13F2N3O3/c1-19-6-2-4-17-5-3-8(7-9(17)18)11-15-16-12(20-11)10(13)14/h3,5,7,10H,2,4,6H2,1H3 |
| InChIKey | JAQDPJJXBISVMF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|