C57H58O — CID 167347055
2-[1,2,3,4,5,6,7,8-octamethyl-10-(1,3,4,5,6,7,8,9,10-nonamethylphenanthren-2-yl)anthracen-9-yl]dibenzofuran (PubChem CID 167347055) has the molecular formula C57H58O and a molecular weight of 759.09 g/mol. Its IUPAC name is 2-[1,2,3,4,5,6,7,8-octamethyl-10-(1,3,4,5,6,7,8,9,10-nonamethylphenanthren-2-yl)anthracen-9-yl]dibenzofuran.
| Compound Name | 2-[1,2,3,4,5,6,7,8-octamethyl-10-(1,3,4,5,6,7,8,9,10-nonamethylphenanthren-2-yl)anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 167347055 |
| Molecular Formula | C57H58O |
| Molecular Weight | 759.09 g/mol |
| Exact Mass | 758.45 |
| IUPAC Name | 2-[1,2,3,4,5,6,7,8-octamethyl-10-(1,3,4,5,6,7,8,9,10-nonamethylphenanthren-2-yl)anthracen-9-yl]dibenzofuran |
| SMILES | Cc1c(C)c(C)c2c(-c3c(C)c(C)c4c(c3C)c(C)c(C)c3c(C)c(C)c(C)c(C)c34)c3c(C)c(C)c(C)c(C)c3c(-c3ccc4oc5ccccc5c4c3)c2c1C |
| InChI | InChI=1S/C57H58O/c1-25-26(2)32(8)50-47(31(25)7)37(13)38(14)48-41(17)49(39(15)40(16)51(48)50)57-54-35(11)29(5)27(3)33(9)52(54)56(53-34(10)28(4)30(6)36(12)55(53)57)42-22-23-46-44(24-42)43-20-18-19-21-45(43)58-46/h18-24H,1-17H3 |
| InChIKey | USHMWYXJNXYEOP-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.09 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|