C55H48O — CID 167347291
1-[10-(9,9-dimethyl-7-phenylfluoren-2-yl)-1,2,3,4,5,6,7,8-octamethylanthracen-9-yl]dibenzofuran (PubChem CID 167347291) has the molecular formula C55H48O and a molecular weight of 724.99 g/mol. Its IUPAC name is 1-[10-(9,9-dimethyl-7-phenylfluoren-2-yl)-1,2,3,4,5,6,7,8-octamethylanthracen-9-yl]dibenzofuran.
| Compound Name | 1-[10-(9,9-dimethyl-7-phenylfluoren-2-yl)-1,2,3,4,5,6,7,8-octamethylanthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 167347291 |
| Molecular Formula | C55H48O |
| Molecular Weight | 724.99 g/mol |
| Exact Mass | 724.37 |
| IUPAC Name | 1-[10-(9,9-dimethyl-7-phenylfluoren-2-yl)-1,2,3,4,5,6,7,8-octamethylanthracen-9-yl]dibenzofuran |
| SMILES | Cc1c(C)c(C)c2c(-c3cccc4oc5ccccc5c34)c3c(C)c(C)c(C)c(C)c3c(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccccc5)ccc3-4)c2c1C |
| InChI | InChI=1S/C55H48O/c1-29-31(3)35(7)50-48(33(29)5)52(39-24-26-41-40-25-23-38(37-17-12-11-13-18-37)27-44(40)55(9,10)45(41)28-39)49-34(6)30(2)32(4)36(8)51(49)54(50)43-20-16-22-47-53(43)42-19-14-15-21-46(42)56-47/h11-28H,1-10H3 |
| InChIKey | ODMWWPBPGSBAEI-UHFFFAOYSA-N |
| XLogP | 15.67 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.99 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|