About 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline
5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline (PubChem CID 16734816) has the molecular formula C22H20F3N5
and a molecular weight of 411.43 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline.
Molecular Properties
| Compound Name | 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline |
| PubChem CID | 16734816 |
| Molecular Formula | C22H20F3N5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline |
| SMILES | CN1CCN(c2cc3cnn(-c4cccc(C(F)(F)F)c4)c3c3ccncc23)CC1 |
| InChI | InChI=1S/C22H20F3N5/c1-28-7-9-29(10-8-28)20-11-15-13-27-30(21(15)18-5-6-26-14-19(18)20)17-4-2-3-16(12-17)22(23,24)25/h2-6,11-14H,7-10H2,1H3 |
| InChIKey | MHYBRTSBYFGKGB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
The IUPAC name of 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline (CID 16734816) is 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline.
What is the SMILES notation for 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
The canonical SMILES for 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline is CN1CCN(c2cc3cnn(-c4cccc(C(F)(F)F)c4)c3c3ccncc23)CC1.
What is the InChIKey of 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
The InChIKey is MHYBRTSBYFGKGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F3N5/c1-28-7-9-29(10-8-28)20-11-15-13-27-30(21(15)18-5-6-26-14-19(18)20)17-4-2-3-16(12-17)22(23,24)25/h2-6,11-14H,7-10H2,1H3.
What are the key properties of 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline?
5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline has a molecular weight of 411.43 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylpiperazin-1-yl)-1-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-f]isoquinoline is sourced from PubChem (CID 16734816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).