C22H38FN5O2 — CID 167348441
N-[(3R,5R)-5-(4-acetylpiperazin-1-yl)-1-methylpiperidin-3-yl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348441) has the molecular formula C22H38FN5O2 and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[(3R,5R)-5-(4-acetylpiperazin-1-yl)-1-methylpiperidin-3-yl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(3R,5R)-5-(4-acetylpiperazin-1-yl)-1-methylpiperidin-3-yl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348441 |
| Molecular Formula | C22H38FN5O2 |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | N-[(3R,5R)-5-(4-acetylpiperazin-1-yl)-1-methylpiperidin-3-yl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CCN([C@@H]2C[C@@H](NC(=O)C3CC4C(F)CCC(C)C4N3)CN(C)C2)CC1 |
| InChI | InChI=1S/C22H38FN5O2/c1-14-4-5-19(23)18-11-20(25-21(14)18)22(30)24-16-10-17(13-26(3)12-16)28-8-6-27(7-9-28)15(2)29/h14,16-21,25H,4-13H2,1-3H3,(H,24,30)/t14?,16-,17-,18?,19?,20?,21?/m1/s1 |
| InChIKey | RSLSBSVQAFWBEA-LMEDNSDBSA-N |
| XLogP | 0.45 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |