C34H33N5O2 — CID 16734945
31-(dimethylamino)-5,15,25,32-tetrazaheptacyclo[28.2.2.15,12.118,25.06,11.013,17.019,24]hexatriaconta-1(32),6,8,10,12(36),13(17),18(35),19,21,23,30,33-dodecaene-14,16-dione (PubChem CID 16734945) has the molecular formula C34H33N5O2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 31-(dimethylamino)-5,15,25,32-tetrazaheptacyclo[28.2.2.15,12.118,25.06,11.013,17.019,24]hexatriaconta-1(32),6,8,10,12(36),13(17),18(35),19,21,23,30,33-dodecaene-14,16-dione.
| Compound Name | 31-(dimethylamino)-5,15,25,32-tetrazaheptacyclo[28.2.2.15,12.118,25.06,11.013,17.019,24]hexatriaconta-1(32),6,8,10,12(36),13(17),18(35),19,21,23,30,33-dodecaene-14,16-dione |
|---|---|
| PubChem CID | 16734945 |
| Molecular Formula | C34H33N5O2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 31-(dimethylamino)-5,15,25,32-tetrazaheptacyclo[28.2.2.15,12.118,25.06,11.013,17.019,24]hexatriaconta-1(32),6,8,10,12(36),13(17),18(35),19,21,23,30,33-dodecaene-14,16-dione |
| SMILES | CN(C)c1nc2ccc1CCCCn1cc(c3ccccc31)C1=C(C(=O)NC1=O)c1cn(c3ccccc13)CCC2 |
| InChI | InChI=1S/C34H33N5O2/c1-37(2)32-22-10-7-8-18-38-20-26(24-12-3-5-14-28(24)38)30-31(34(41)36-33(30)40)27-21-39(29-15-6-4-13-25(27)29)19-9-11-23(35-32)17-16-22/h3-6,12-17,20-21H,7-11,18-19H2,1-2H3,(H,36,40,41) |
| InChIKey | WHEOASILVTUPNR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|