About 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine
2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine (PubChem CID 167350132) has the molecular formula C15H21FN2
and a molecular weight of 248.34 g/mol. Its IUPAC name is 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine |
| PubChem CID | 167350132 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)c1nc2cccc(F)n2c1C(C)(C)C |
| InChI | InChI=1S/C15H21FN2/c1-14(2,3)12-13(15(4,5)6)18-10(16)8-7-9-11(18)17-12/h7-9H,1-6H3 |
| InChIKey | YMEWXTZNGFXYHV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine?
The IUPAC name of 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine (CID 167350132) is 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine?
The canonical SMILES for 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine is CC(C)(C)c1nc2cccc(F)n2c1C(C)(C)C.
What is the InChIKey of 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine?
The InChIKey is YMEWXTZNGFXYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2/c1-14(2,3)12-13(15(4,5)6)18-10(16)8-7-9-11(18)17-12/h7-9H,1-6H3.
What are the key properties of 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine?
2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine has a molecular weight of 248.34 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-5-fluoroimidazo[1,2-a]pyridine is sourced from PubChem (CID 167350132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).