About methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate
methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate (PubChem CID 167350243) has the molecular formula C14H30O5Si
and a molecular weight of 306.48 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate.
Molecular Properties
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate |
| PubChem CID | 167350243 |
| Molecular Formula | C14H30O5Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate |
| SMILES | COC(=O)CC(CC(OC)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O5Si/c1-14(2,3)20(7,8)19-11(9-12(15)16-4)10-13(17-5)18-6/h11,13H,9-10H2,1-8H3 |
| InChIKey | CCUSWWSFDRGSHR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate?
The IUPAC name of methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate (CID 167350243) is methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate.
What is the SMILES notation for methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate?
The canonical SMILES for methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate is COC(=O)CC(CC(OC)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate?
The InChIKey is CCUSWWSFDRGSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O5Si/c1-14(2,3)20(7,8)19-11(9-12(15)16-4)10-13(17-5)18-6/h11,13H,9-10H2,1-8H3.
What are the key properties of methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate?
methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate has a molecular weight of 306.48 g/mol, XLogP of 2.95, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate is sourced from PubChem (CID 167350243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).