C34H37N3O2 — CID 16735041
1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(4-phenylphenyl)urea (PubChem CID 16735041) has the molecular formula C34H37N3O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(4-phenylphenyl)urea.
| Compound Name | 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 16735041 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(4-phenylphenyl)urea |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)N(CCC(c1ccccc1)c1ccccc1)CCN1CCOCC1 |
| InChI | InChI=1S/C34H37N3O2/c38-34(35-32-18-16-29(17-19-32)28-10-4-1-5-11-28)37(23-22-36-24-26-39-27-25-36)21-20-33(30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-19,33H,20-27H2,(H,35,38) |
| InChIKey | YDEVVQSWZMOZSN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |