About 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea
1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea (PubChem CID 16735042) has the molecular formula C34H37N3O2
and a molecular weight of 519.69 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea.
Molecular Properties
| Compound Name | 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea |
| PubChem CID | 16735042 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)N(CCC(c1ccccc1)c1ccccc1)CCN1CCOCC1 |
| InChI | InChI=1S/C34H37N3O2/c38-34(35-32-18-10-17-31(27-32)28-11-4-1-5-12-28)37(22-21-36-23-25-39-26-24-36)20-19-33(29-13-6-2-7-14-29)30-15-8-3-9-16-30/h1-18,27,33H,19-26H2,(H,35,38) |
| InChIKey | UVBWTPFWQVLREE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea?
The IUPAC name of 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea (CID 16735042) is 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea.
What is the SMILES notation for 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea?
The canonical SMILES for 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea is O=C(Nc1cccc(-c2ccccc2)c1)N(CCC(c1ccccc1)c1ccccc1)CCN1CCOCC1.
What is the InChIKey of 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea?
The InChIKey is UVBWTPFWQVLREE-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H37N3O2/c38-34(35-32-18-10-17-31(27-32)28-11-4-1-5-12-28)37(22-21-36-23-25-39-26-24-36)20-19-33(29-13-6-2-7-14-29)30-15-8-3-9-16-30/h1-18,27,33H,19-26H2,(H,35,38).
What are the key properties of 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea?
1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea has a molecular weight of 519.69 g/mol, XLogP of 6.74, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diphenylpropyl)-1-(2-morpholin-4-ylethyl)-3-(3-phenylphenyl)urea is sourced from PubChem (CID 16735042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).