About 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea
1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea (PubChem CID 16735045) has the molecular formula C32H35N3O3
and a molecular weight of 509.65 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea.
Molecular Properties
| Compound Name | 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea |
| PubChem CID | 16735045 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea |
| SMILES | O=C(Nc1cccc(-c2ccco2)c1)N(CCC(c1ccccc1)c1ccccc1)CCN1CCOCC1 |
| InChI | InChI=1S/C32H35N3O3/c36-32(33-29-14-7-13-28(25-29)31-15-8-22-38-31)35(19-18-34-20-23-37-24-21-34)17-16-30(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-15,22,25,30H,16-21,23-24H2,(H,33,36) |
| InChIKey | CGHGDHYCILCDMZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea?
The IUPAC name of 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea (CID 16735045) is 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea.
What is the SMILES notation for 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea?
The canonical SMILES for 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea is O=C(Nc1cccc(-c2ccco2)c1)N(CCC(c1ccccc1)c1ccccc1)CCN1CCOCC1.
What is the InChIKey of 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea?
The InChIKey is CGHGDHYCILCDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H35N3O3/c36-32(33-29-14-7-13-28(25-29)31-15-8-22-38-31)35(19-18-34-20-23-37-24-21-34)17-16-30(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-15,22,25,30H,16-21,23-24H2,(H,33,36).
What are the key properties of 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea?
1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea has a molecular weight of 509.65 g/mol, XLogP of 6.33, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diphenylpropyl)-3-[3-(furan-2-yl)phenyl]-1-(2-morpholin-4-ylethyl)urea is sourced from PubChem (CID 16735045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).