C15H17BrN6O3 — CID 16735064
9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]purine-2,6-diamine (PubChem CID 16735064) has the molecular formula C15H17BrN6O3 and a molecular weight of 409.24 g/mol. Its IUPAC name is 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]purine-2,6-diamine.
| Compound Name | 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 16735064 |
| Molecular Formula | C15H17BrN6O3 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]purine-2,6-diamine |
| SMILES | COc1cc(Cn2cnc3c(N)nc(N)nc32)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C15H17BrN6O3/c1-23-8-4-7(9(16)12(25-3)11(8)24-2)5-22-6-19-10-13(17)20-15(18)21-14(10)22/h4,6H,5H2,1-3H3,(H4,17,18,20,21) |
| InChIKey | CDZXHWVIZVEVSV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |