About 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine
2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine (PubChem CID 167350776) has the molecular formula C16H12N4O
and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine.
Molecular Properties
| Compound Name | 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine |
| PubChem CID | 167350776 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine |
| SMILES | COc1nccc2nc(-c3n[nH]c4ccccc34)ccc12 |
| InChI | InChI=1S/C16H12N4O/c1-21-16-11-6-7-14(18-12(11)8-9-17-16)15-10-4-2-3-5-13(10)19-20-15/h2-9H,1H3,(H,19,20) |
| InChIKey | RPGVOIMEIKWWJO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine?
The IUPAC name of 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine (CID 167350776) is 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine.
What is the SMILES notation for 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine?
The canonical SMILES for 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine is COc1nccc2nc(-c3n[nH]c4ccccc34)ccc12.
What is the InChIKey of 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine?
The InChIKey is RPGVOIMEIKWWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O/c1-21-16-11-6-7-14(18-12(11)8-9-17-16)15-10-4-2-3-5-13(10)19-20-15/h2-9H,1H3,(H,19,20).
What are the key properties of 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine?
2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine has a molecular weight of 276.30 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indazol-3-yl)-5-methoxy-1,6-naphthyridine is sourced from PubChem (CID 167350776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).