About 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile
3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile (PubChem CID 16735108) has the molecular formula C21H27NOSi
and a molecular weight of 337.54 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile |
| PubChem CID | 16735108 |
| Molecular Formula | C21H27NOSi |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile |
| SMILES | CC(C)(C#N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H27NOSi/c1-20(2,3)24(18-12-8-6-9-13-18,19-14-10-7-11-15-19)23-17-21(4,5)16-22/h6-15H,17H2,1-5H3 |
| InChIKey | MSSLGWZYNYTSSB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile?
The IUPAC name of 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile (CID 16735108) is 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile is CC(C)(C#N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile?
The InChIKey is MSSLGWZYNYTSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NOSi/c1-20(2,3)24(18-12-8-6-9-13-18,19-14-10-7-11-15-19)23-17-21(4,5)16-22/h6-15H,17H2,1-5H3.
What are the key properties of 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile?
3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile has a molecular weight of 337.54 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylpropanenitrile is sourced from PubChem (CID 16735108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).