C68H46N4O4 — CID 167351178
1,4-bis[4-(N-phenylanilino)phenyl]-2,5-bis(4-phenylbenzoyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 167351178) has the molecular formula C68H46N4O4 and a molecular weight of 983.14 g/mol. Its IUPAC name is 1,4-bis[4-(N-phenylanilino)phenyl]-2,5-bis(4-phenylbenzoyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis[4-(N-phenylanilino)phenyl]-2,5-bis(4-phenylbenzoyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 167351178 |
| Molecular Formula | C68H46N4O4 |
| Molecular Weight | 983.14 g/mol |
| Exact Mass | 982.35 |
| IUPAC Name | 1,4-bis[4-(N-phenylanilino)phenyl]-2,5-bis(4-phenylbenzoyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | O=C1C2=C(c3ccc(N(c4ccccc4)c4ccccc4)cc3)N(C(=O)c3ccc(-c4ccccc4)cc3)C(=O)C2=C(c2ccc(N(c3ccccc3)c3ccccc3)cc2)N1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C68H46N4O4/c73-65(53-35-31-49(32-36-53)47-19-7-1-8-20-47)71-63(51-39-43-59(44-40-51)69(55-23-11-3-12-24-55)56-25-13-4-14-26-56)61-62(67(71)75)64(72(68(61)76)66(74)54-37-33-50(34-38-54)48-21-9-2-10-22-48)52-41-45-60(46-42-52)70(57-27-15-5-16-28-57)58-29-17-6-18-30-58/h1-46H |
| InChIKey | ZGOSTXQWOQNTSA-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.14 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|