C21H26N2O7S — CID 16735140
(Z)-but-2-enedioic acid;8-methyl-7-(2-methylsulfanylethoxy)-4-piperazin-1-ylchromen-2-one (PubChem CID 16735140) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;8-methyl-7-(2-methylsulfanylethoxy)-4-piperazin-1-ylchromen-2-one.
| Compound Name | (Z)-but-2-enedioic acid;8-methyl-7-(2-methylsulfanylethoxy)-4-piperazin-1-ylchromen-2-one |
|---|---|
| PubChem CID | 16735140 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;8-methyl-7-(2-methylsulfanylethoxy)-4-piperazin-1-ylchromen-2-one |
| SMILES | CSCCOc1ccc2c(N3CCNCC3)cc(=O)oc2c1C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H22N2O3S.C4H4O4/c1-12-15(21-9-10-23-2)4-3-13-14(11-16(20)22-17(12)13)19-7-5-18-6-8-19;5-3(6)1-2-4(7)8/h3-4,11,18H,5-10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VSRMQAJIBQHTJS-BTJKTKAUSA-N |
| XLogP | 1.96 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|