C12H21NO2 — CID 167352151
8-tert-butyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one (PubChem CID 167352151) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 8-tert-butyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one.
| Compound Name | 8-tert-butyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 167352151 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 8-tert-butyl-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-4-one |
| SMILES | CC(C)(C)C1CCN2C(=O)COCC2C1 |
| InChI | InChI=1S/C12H21NO2/c1-12(2,3)9-4-5-13-10(6-9)7-15-8-11(13)14/h9-10H,4-8H2,1-3H3 |
| InChIKey | FVWXJLGHAXQDMX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |