About (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one
(1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one (PubChem CID 167352172) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one.
Molecular Properties
| Compound Name | (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one |
| PubChem CID | 167352172 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C[C@H](O)C1CC1 |
| InChI | InChI=1S/C10H18O2/c1-10(2,3)9(12)6-8(11)7-4-5-7/h7-8,11H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | GCGJUYIRAYAAGU-QMMMGPOBSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one?
The IUPAC name of (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one (CID 167352172) is (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one.
What is the SMILES notation for (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one?
The canonical SMILES for (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one is CC(C)(C)C(=O)C[C@H](O)C1CC1.
What is the InChIKey of (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one?
The InChIKey is GCGJUYIRAYAAGU-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H18O2/c1-10(2,3)9(12)6-8(11)7-4-5-7/h7-8,11H,4-6H2,1-3H3/t8-/m0/s1.
What are the key properties of (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one?
(1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one has a molecular weight of 170.25 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclopropyl-1-hydroxy-4,4-dimethylpentan-3-one is sourced from PubChem (CID 167352172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).