C39H44N6O5 — CID 16735234
(2S)-6-amino-2-[[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]amino]-N-[(2S)-1-(4-hydroxyanilino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]hexanamide (PubChem CID 16735234) has the molecular formula C39H44N6O5 and a molecular weight of 676.82 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]amino]-N-[(2S)-1-(4-hydroxyanilino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]amino]-N-[(2S)-1-(4-hydroxyanilino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 16735234 |
| Molecular Formula | C39H44N6O5 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]amino]-N-[(2S)-1-(4-hydroxyanilino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1ccc(OCc2ccccc2)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C39H44N6O5/c40-21-7-6-12-35(44-37(47)33(41)22-26-13-19-31(20-14-26)50-25-27-8-2-1-3-9-27)38(48)45-36(39(49)43-29-15-17-30(46)18-16-29)23-28-24-42-34-11-5-4-10-32(28)34/h1-5,8-11,13-20,24,33,35-36,42,46H,6-7,12,21-23,25,40-41H2,(H,43,49)(H,44,47)(H,45,48)/t33-,35-,36-/m0/s1 |
| InChIKey | APAXYZSAKSDVKN-QBDOPFNQSA-N |
| XLogP | 4.30 |
| TPSA | 184.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|