C19H26N2O4 — CID 167352398
2-[(E)-1-[1-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]cyclohexyl]ethylideneamino]oxyacetic acid (PubChem CID 167352398) has the molecular formula C19H26N2O4 and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-[(E)-1-[1-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]cyclohexyl]ethylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-1-[1-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]cyclohexyl]ethylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 167352398 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-[(E)-1-[1-[[4-[2-(deuterioamino)-2-oxoethyl]phenyl]methyl]cyclohexyl]ethylideneamino]oxyacetic acid |
| SMILES | [2H]NC(=O)Cc1ccc(CC2(/C(C)=N/OCC(=O)O)CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-14(21-25-13-18(23)24)19(9-3-2-4-10-19)12-16-7-5-15(6-8-16)11-17(20)22/h5-8H,2-4,9-13H2,1H3,(H2,20,22)(H,23,24)/b21-14+/i/hD |
| InChIKey | FPGPJNJNRIKJRW-ZXAKGGLJSA-N |
| XLogP | 2.68 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|