C9H12O3 — CID 167353398
(2E,3E,5R)-2,3-di(ethylidene)-5-hydroxyoxan-4-one (PubChem CID 167353398) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (2E,3E,5R)-2,3-di(ethylidene)-5-hydroxyoxan-4-one.
| Compound Name | (2E,3E,5R)-2,3-di(ethylidene)-5-hydroxyoxan-4-one |
|---|---|
| PubChem CID | 167353398 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (2E,3E,5R)-2,3-di(ethylidene)-5-hydroxyoxan-4-one |
| SMILES | C/C=C1/OC[C@@H](O)C(=O)/C1=C/C |
| InChI | InChI=1S/C9H12O3/c1-3-6-8(4-2)12-5-7(10)9(6)11/h3-4,7,10H,5H2,1-2H3/b6-3+,8-4+/t7-/m1/s1 |
| InChIKey | ZLPMGYMXWLXMHQ-HSNMEPCLSA-N |
| XLogP | 0.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|