C17H14FN5O2S — CID 16735390
3-[(3,4-dimethoxyphenyl)methyl]-6-(2-fluoro-4-pyridinyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 16735390) has the molecular formula C17H14FN5O2S and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-fluoro-4-pyridinyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-fluoro-4-pyridinyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 16735390 |
| Molecular Formula | C17H14FN5O2S |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-fluoro-4-pyridinyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccc(Cc2nnc3sc(-c4ccnc(F)c4)nn23)cc1OC |
| InChI | InChI=1S/C17H14FN5O2S/c1-24-12-4-3-10(7-13(12)25-2)8-15-20-21-17-23(15)22-16(26-17)11-5-6-19-14(18)9-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | RUFYRWIFNZQOSV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|