C27H32ClN5O4 — CID 16735411
4-[2-amino-3-chloro-4-(ethylamino)-5-formylphenoxy]-N-methyl-7-[(1-methylpiperidin-4-yl)methoxy]quinoline-6-carboxamide (PubChem CID 16735411) has the molecular formula C27H32ClN5O4 and a molecular weight of 526.04 g/mol. Its IUPAC name is 4-[2-amino-3-chloro-4-(ethylamino)-5-formylphenoxy]-N-methyl-7-[(1-methylpiperidin-4-yl)methoxy]quinoline-6-carboxamide.
| Compound Name | 4-[2-amino-3-chloro-4-(ethylamino)-5-formylphenoxy]-N-methyl-7-[(1-methylpiperidin-4-yl)methoxy]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 16735411 |
| Molecular Formula | C27H32ClN5O4 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 4-[2-amino-3-chloro-4-(ethylamino)-5-formylphenoxy]-N-methyl-7-[(1-methylpiperidin-4-yl)methoxy]quinoline-6-carboxamide |
| SMILES | CCNc1c(C=O)cc(Oc2ccnc3cc(OCC4CCN(C)CC4)c(C(=O)NC)cc23)c(N)c1Cl |
| InChI | InChI=1S/C27H32ClN5O4/c1-4-31-26-17(14-34)11-23(25(29)24(26)28)37-21-5-8-32-20-13-22(19(12-18(20)21)27(35)30-2)36-15-16-6-9-33(3)10-7-16/h5,8,11-14,16,31H,4,6-7,9-10,15,29H2,1-3H3,(H,30,35) |
| InChIKey | MUHCGUTUPGMCTA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|